C14H24N2O2 — CID 106185999
2,3-dimethyl-3-[(3-propoxy-2-pyridinyl)amino]butan-2-ol (PubChem CID 106185999) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2,3-dimethyl-3-[(3-propoxy-2-pyridinyl)amino]butan-2-ol.
| Compound Name | 2,3-dimethyl-3-[(3-propoxy-2-pyridinyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 106185999 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2,3-dimethyl-3-[(3-propoxy-2-pyridinyl)amino]butan-2-ol |
| SMILES | CCCOc1cccnc1NC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C14H24N2O2/c1-6-10-18-11-8-7-9-15-12(11)16-13(2,3)14(4,5)17/h7-9,17H,6,10H2,1-5H3,(H,15,16) |
| InChIKey | WLLWWWMYWPMAOC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |