C12H20N2O3 — CID 106307052
2-[3-[(3-ethoxy-2-pyridinyl)amino]propoxy]ethanol (PubChem CID 106307052) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-[3-[(3-ethoxy-2-pyridinyl)amino]propoxy]ethanol.
| Compound Name | 2-[3-[(3-ethoxy-2-pyridinyl)amino]propoxy]ethanol |
|---|---|
| PubChem CID | 106307052 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-[3-[(3-ethoxy-2-pyridinyl)amino]propoxy]ethanol |
| SMILES | CCOc1cccnc1NCCCOCCO |
| InChI | InChI=1S/C12H20N2O3/c1-2-17-11-5-3-6-13-12(11)14-7-4-9-16-10-8-15/h3,5-6,15H,2,4,7-10H2,1H3,(H,13,14) |
| InChIKey | ZGERCTRCLOLRDI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|