C13H22N2O2 — CID 82341843
[2-(3-butoxypropylamino)-3-pyridinyl]methanol (PubChem CID 82341843) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is [2-(3-butoxypropylamino)-3-pyridinyl]methanol.
| Compound Name | [2-(3-butoxypropylamino)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 82341843 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | [2-(3-butoxypropylamino)-3-pyridinyl]methanol |
| SMILES | CCCCOCCCNc1ncccc1CO |
| InChI | InChI=1S/C13H22N2O2/c1-2-3-9-17-10-5-8-15-13-12(11-16)6-4-7-14-13/h4,6-7,16H,2-3,5,8-11H2,1H3,(H,14,15) |
| InChIKey | GEDBPHMJFPFHFL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|