C17H28N6O — CID 75533381
1-(3-butoxypropyl)-3-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-methylguanidine (PubChem CID 75533381) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-methylguanidine.
| Compound Name | 1-(3-butoxypropyl)-3-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 75533381 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-methylguanidine |
| SMILES | CCCCOCCCN/C(=N\C)NCCNc1ncccc1C#N |
| InChI | InChI=1S/C17H28N6O/c1-3-4-12-24-13-6-9-22-17(19-2)23-11-10-21-16-15(14-18)7-5-8-20-16/h5,7-8H,3-4,6,9-13H2,1-2H3,(H,20,21)(H2,19,22,23) |
| InChIKey | JDSURTHWQWAIMQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|