C14H24N2O2 — CID 106115743
3-[[(3-ethoxy-2-pyridinyl)amino]methyl]hexan-1-ol (PubChem CID 106115743) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-[[(3-ethoxy-2-pyridinyl)amino]methyl]hexan-1-ol.
| Compound Name | 3-[[(3-ethoxy-2-pyridinyl)amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 106115743 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 3-[[(3-ethoxy-2-pyridinyl)amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1ncccc1OCC |
| InChI | InChI=1S/C14H24N2O2/c1-3-6-12(8-10-17)11-16-14-13(18-4-2)7-5-9-15-14/h5,7,9,12,17H,3-4,6,8,10-11H2,1-2H3,(H,15,16) |
| InChIKey | LDECCIUUHXTXEX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |