C10H15N3O3 — CID 106170981
3-[(3-ethoxy-2-pyridinyl)amino]-2-hydroxypropanamide (PubChem CID 106170981) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-[(3-ethoxy-2-pyridinyl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(3-ethoxy-2-pyridinyl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106170981 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3-[(3-ethoxy-2-pyridinyl)amino]-2-hydroxypropanamide |
| SMILES | CCOc1cccnc1NCC(O)C(N)=O |
| InChI | InChI=1S/C10H15N3O3/c1-2-16-8-4-3-5-12-10(8)13-6-7(14)9(11)15/h3-5,7,14H,2,6H2,1H3,(H2,11,15)(H,12,13) |
| InChIKey | QBHOZEGVBKDRON-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |