C13H17N3OS — CID 114127933
3-ethoxy-N-[2-(1,3-thiazol-2-yl)propyl]pyridin-2-amine (PubChem CID 114127933) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 3-ethoxy-N-[2-(1,3-thiazol-2-yl)propyl]pyridin-2-amine.
| Compound Name | 3-ethoxy-N-[2-(1,3-thiazol-2-yl)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 114127933 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3-ethoxy-N-[2-(1,3-thiazol-2-yl)propyl]pyridin-2-amine |
| SMILES | CCOc1cccnc1NCC(C)c1nccs1 |
| InChI | InChI=1S/C13H17N3OS/c1-3-17-11-5-4-6-14-12(11)16-9-10(2)13-15-7-8-18-13/h4-8,10H,3,9H2,1-2H3,(H,14,16) |
| InChIKey | BTARAWJCRMYCGJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |