C7H10N4O2 — CID 106170861
2-hydroxy-3-(pyridazin-3-ylamino)propanamide (PubChem CID 106170861) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-hydroxy-3-(pyridazin-3-ylamino)propanamide.
| Compound Name | 2-hydroxy-3-(pyridazin-3-ylamino)propanamide |
|---|---|
| PubChem CID | 106170861 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2-hydroxy-3-(pyridazin-3-ylamino)propanamide |
| SMILES | NC(=O)C(O)CNc1cccnn1 |
| InChI | InChI=1S/C7H10N4O2/c8-7(13)5(12)4-9-6-2-1-3-10-11-6/h1-3,5,12H,4H2,(H2,8,13)(H,9,11) |
| InChIKey | REZYNKTUXDPZJT-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |