C9H14N4 — CID 63759108
1-cyclopropyl-N'-pyridazin-3-ylethane-1,2-diamine (PubChem CID 63759108) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 1-cyclopropyl-N'-pyridazin-3-ylethane-1,2-diamine.
| Compound Name | 1-cyclopropyl-N'-pyridazin-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 63759108 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1-cyclopropyl-N'-pyridazin-3-ylethane-1,2-diamine |
| SMILES | NC(CNc1cccnn1)C1CC1 |
| InChI | InChI=1S/C9H14N4/c10-8(7-3-4-7)6-11-9-2-1-5-12-13-9/h1-2,5,7-8H,3-4,6,10H2,(H,11,13) |
| InChIKey | KXKVARCMMQJSAK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |