C10H16N4 — CID 130655450
1-cyclobutyl-N'-pyrimidin-2-ylethane-1,2-diamine (PubChem CID 130655450) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 1-cyclobutyl-N'-pyrimidin-2-ylethane-1,2-diamine.
| Compound Name | 1-cyclobutyl-N'-pyrimidin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 130655450 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-cyclobutyl-N'-pyrimidin-2-ylethane-1,2-diamine |
| SMILES | NC(CNc1ncccn1)C1CCC1 |
| InChI | InChI=1S/C10H16N4/c11-9(8-3-1-4-8)7-14-10-12-5-2-6-13-10/h2,5-6,8-9H,1,3-4,7,11H2,(H,12,13,14) |
| InChIKey | WUQHUNDHOIALOO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |