C11H17N3 — CID 62482015
N-(2-cyclopentylethyl)pyridazin-3-amine (PubChem CID 62482015) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N-(2-cyclopentylethyl)pyridazin-3-amine.
| Compound Name | N-(2-cyclopentylethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 62482015 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N-(2-cyclopentylethyl)pyridazin-3-amine |
| SMILES | c1cnnc(NCCC2CCCC2)c1 |
| InChI | InChI=1S/C11H17N3/c1-2-5-10(4-1)7-9-12-11-6-3-8-13-14-11/h3,6,8,10H,1-2,4-5,7,9H2,(H,12,14) |
| InChIKey | HYQWZMDIXZSWNF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |