C12H17FN2 — CID 61228606
N-(2-cyclopentylethyl)-6-fluoropyridin-2-amine (PubChem CID 61228606) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is N-(2-cyclopentylethyl)-6-fluoropyridin-2-amine.
| Compound Name | N-(2-cyclopentylethyl)-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 61228606 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | N-(2-cyclopentylethyl)-6-fluoropyridin-2-amine |
| SMILES | Fc1cccc(NCCC2CCCC2)n1 |
| InChI | InChI=1S/C12H17FN2/c13-11-6-3-7-12(15-11)14-9-8-10-4-1-2-5-10/h3,6-7,10H,1-2,4-5,8-9H2,(H,14,15) |
| InChIKey | YPCLBMVAMRICCO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|