C22H33N — CID 155323771
N-(2-cyclodecylethyl)cyclodecapentaenamine (PubChem CID 155323771) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is N-(2-cyclodecylethyl)cyclodecapentaenamine.
| Compound Name | N-(2-cyclodecylethyl)cyclodecapentaenamine |
|---|---|
| PubChem CID | 155323771 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | N-(2-cyclodecylethyl)cyclodecapentaenamine |
| SMILES | c1ccccc(NCCC2CCCCCCCCC2)cccc1 |
| InChI | InChI=1S/C22H33N/c1-3-7-11-15-21(16-12-8-4-1)19-20-23-22-17-13-9-5-2-6-10-14-18-22/h2,5-6,9-10,13-14,17-18,21,23H,1,3-4,7-8,11-12,15-16,19-20H2/b5-2-,6-2-,9-5-,10-6+,13-9+,14-10+,17-13+,18-14-,22-17+,22-18+ |
| InChIKey | WZDSHPQVBJHOHY-RXUMAWEMSA-N |
| XLogP | 6.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |