C8H9F3N2 — CID 130610509
N-(3,3-difluoropropyl)-6-fluoropyridin-2-amine (PubChem CID 130610509) has the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. Its IUPAC name is N-(3,3-difluoropropyl)-6-fluoropyridin-2-amine.
| Compound Name | N-(3,3-difluoropropyl)-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 130610509 |
| Molecular Formula | C8H9F3N2 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | N-(3,3-difluoropropyl)-6-fluoropyridin-2-amine |
| SMILES | Fc1cccc(NCCC(F)F)n1 |
| InChI | InChI=1S/C8H9F3N2/c9-6(10)4-5-12-8-3-1-2-7(11)13-8/h1-3,6H,4-5H2,(H,12,13) |
| InChIKey | CGAHJDODONNNQY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|