C11H17FN2 — CID 64597219
N-(2,3-dimethylbutyl)-6-fluoropyridin-2-amine (PubChem CID 64597219) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-6-fluoropyridin-2-amine.
| Compound Name | N-(2,3-dimethylbutyl)-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 64597219 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | N-(2,3-dimethylbutyl)-6-fluoropyridin-2-amine |
| SMILES | CC(C)C(C)CNc1cccc(F)n1 |
| InChI | InChI=1S/C11H17FN2/c1-8(2)9(3)7-13-11-6-4-5-10(12)14-11/h4-6,8-9H,7H2,1-3H3,(H,13,14) |
| InChIKey | LLYPNVUABXMTEK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|