C9H14FN3 — CID 61229371
N-(6-fluoro-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 61229371) has the molecular formula C9H14FN3 and a molecular weight of 183.23 g/mol. Its IUPAC name is N-(6-fluoro-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(6-fluoro-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 61229371 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | N-(6-fluoro-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1cccc(F)n1 |
| InChI | InChI=1S/C9H14FN3/c1-13(2)7-6-11-9-5-3-4-8(10)12-9/h3-5H,6-7H2,1-2H3,(H,11,12) |
| InChIKey | JHKVUEFXYBQNQR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|