C10H16FN3 — CID 61228791
N-(6-fluoro-2-pyridinyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 61228791) has the molecular formula C10H16FN3 and a molecular weight of 197.26 g/mol. Its IUPAC name is N-(6-fluoro-2-pyridinyl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(6-fluoro-2-pyridinyl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 61228791 |
| Molecular Formula | C10H16FN3 |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | N-(6-fluoro-2-pyridinyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1cccc(F)n1 |
| InChI | InChI=1S/C10H16FN3/c1-14(2)8-4-7-12-10-6-3-5-9(11)13-10/h3,5-6H,4,7-8H2,1-2H3,(H,12,13) |
| InChIKey | TWTVUHDSZYEUOU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|