C11H19N3 — CID 60876998
N',N'-dimethyl-N-(6-methyl-2-pyridinyl)propane-1,3-diamine (PubChem CID 60876998) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N',N'-dimethyl-N-(6-methyl-2-pyridinyl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(6-methyl-2-pyridinyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 60876998 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N',N'-dimethyl-N-(6-methyl-2-pyridinyl)propane-1,3-diamine |
| SMILES | Cc1cccc(NCCCN(C)C)n1 |
| InChI | InChI=1S/C11H19N3/c1-10-6-4-7-11(13-10)12-8-5-9-14(2)3/h4,6-7H,5,8-9H2,1-3H3,(H,12,13) |
| InChIKey | OUAKOENLRNOQJD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|