C13H20N4O2 — CID 44997594
N-[3-(dimethylamino)propyl]-N'-(6-methyl-2-pyridinyl)oxamide (PubChem CID 44997594) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N'-(6-methyl-2-pyridinyl)oxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N'-(6-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 44997594 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N'-(6-methyl-2-pyridinyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NCCCN(C)C)n1 |
| InChI | InChI=1S/C13H20N4O2/c1-10-6-4-7-11(15-10)16-13(19)12(18)14-8-5-9-17(2)3/h4,6-7H,5,8-9H2,1-3H3,(H,14,18)(H,15,16,19) |
| InChIKey | PWFBUADUBMXTBJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|