C14H21N3O3 — CID 108525224
N'-(6-methyl-2-pyridinyl)-N-(3-propan-2-yloxypropyl)oxamide (PubChem CID 108525224) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is N'-(6-methyl-2-pyridinyl)-N-(3-propan-2-yloxypropyl)oxamide.
| Compound Name | N'-(6-methyl-2-pyridinyl)-N-(3-propan-2-yloxypropyl)oxamide |
|---|---|
| PubChem CID | 108525224 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N'-(6-methyl-2-pyridinyl)-N-(3-propan-2-yloxypropyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NCCCOC(C)C)n1 |
| InChI | InChI=1S/C14H21N3O3/c1-10(2)20-9-5-8-15-13(18)14(19)17-12-7-4-6-11(3)16-12/h4,6-7,10H,5,8-9H2,1-3H3,(H,15,18)(H,16,17,19) |
| InChIKey | LBWZBIFDBNEGQB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|