C11H15N3O2 — CID 44997659
N-(6-methyl-2-pyridinyl)-N'-propan-2-yloxamide (PubChem CID 44997659) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-(6-methyl-2-pyridinyl)-N'-propan-2-yloxamide.
| Compound Name | N-(6-methyl-2-pyridinyl)-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 44997659 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-(6-methyl-2-pyridinyl)-N'-propan-2-yloxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NC(C)C)n1 |
| InChI | InChI=1S/C11H15N3O2/c1-7(2)12-10(15)11(16)14-9-6-4-5-8(3)13-9/h4-7H,1-3H3,(H,12,15)(H,13,14,16) |
| InChIKey | RPYRORXEAYFPCE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|