C12H12N4O2S — CID 108519296
N-(6-methyl-2-pyridinyl)-N'-(4-methyl-1,3-thiazol-2-yl)oxamide (PubChem CID 108519296) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is N-(6-methyl-2-pyridinyl)-N'-(4-methyl-1,3-thiazol-2-yl)oxamide.
| Compound Name | N-(6-methyl-2-pyridinyl)-N'-(4-methyl-1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 108519296 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-(6-methyl-2-pyridinyl)-N'-(4-methyl-1,3-thiazol-2-yl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)Nc2nc(C)cs2)n1 |
| InChI | InChI=1S/C12H12N4O2S/c1-7-4-3-5-9(13-7)15-10(17)11(18)16-12-14-8(2)6-19-12/h3-6H,1-2H3,(H,13,15,17)(H,14,16,18) |
| InChIKey | WKKLJQLDATYMQM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|