C15H13N5O2S2 — CID 19684989
2-N,6-N-bis(4-methyl-1,3-thiazol-2-yl)pyridine-2,6-dicarboxamide (PubChem CID 19684989) has the molecular formula C15H13N5O2S2 and a molecular weight of 359.44 g/mol. Its IUPAC name is 2-N,6-N-bis(4-methyl-1,3-thiazol-2-yl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(4-methyl-1,3-thiazol-2-yl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 19684989 |
| Molecular Formula | C15H13N5O2S2 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2-N,6-N-bis(4-methyl-1,3-thiazol-2-yl)pyridine-2,6-dicarboxamide |
| SMILES | Cc1csc(NC(=O)c2cccc(C(=O)Nc3nc(C)cs3)n2)n1 |
| InChI | InChI=1S/C15H13N5O2S2/c1-8-6-23-14(16-8)19-12(21)10-4-3-5-11(18-10)13(22)20-15-17-9(2)7-24-15/h3-7H,1-2H3,(H,16,19,21)(H,17,20,22) |
| InChIKey | ICJFYXVIKQDZBH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |