C9H10N6OS — CID 62237852
6-hydrazinyl-N-(4-methyl-1,3-thiazol-2-yl)pyridazine-3-carboxamide (PubChem CID 62237852) has the molecular formula C9H10N6OS and a molecular weight of 250.29 g/mol. Its IUPAC name is 6-hydrazinyl-N-(4-methyl-1,3-thiazol-2-yl)pyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-(4-methyl-1,3-thiazol-2-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62237852 |
| Molecular Formula | C9H10N6OS |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 6-hydrazinyl-N-(4-methyl-1,3-thiazol-2-yl)pyridazine-3-carboxamide |
| SMILES | Cc1csc(NC(=O)c2ccc(NN)nn2)n1 |
| InChI | InChI=1S/C9H10N6OS/c1-5-4-17-9(11-5)12-8(16)6-2-3-7(13-10)15-14-6/h2-4H,10H2,1H3,(H,13,15)(H,11,12,16) |
| InChIKey | TXGNGYBPBYHQEG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|