C12H11N3O2S — CID 47106736
4-N-(4-methyl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide (PubChem CID 47106736) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 4-N-(4-methyl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(4-methyl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 47106736 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-N-(4-methyl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide |
| SMILES | Cc1csc(NC(=O)c2ccc(C(N)=O)cc2)n1 |
| InChI | InChI=1S/C12H11N3O2S/c1-7-6-18-12(14-7)15-11(17)9-4-2-8(3-5-9)10(13)16/h2-6H,1H3,(H2,13,16)(H,14,15,17) |
| InChIKey | GPJAXIBCPFRXKI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |