C11H12N2OS2 — CID 25237547
5-ethyl-N-(4-methyl-1,3-thiazol-2-yl)thiophene-3-carboxamide (PubChem CID 25237547) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 5-ethyl-N-(4-methyl-1,3-thiazol-2-yl)thiophene-3-carboxamide.
| Compound Name | 5-ethyl-N-(4-methyl-1,3-thiazol-2-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 25237547 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 5-ethyl-N-(4-methyl-1,3-thiazol-2-yl)thiophene-3-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2nc(C)cs2)cs1 |
| InChI | InChI=1S/C11H12N2OS2/c1-3-9-4-8(6-15-9)10(14)13-11-12-7(2)5-16-11/h4-6H,3H2,1-2H3,(H,12,13,14) |
| InChIKey | RNLWFBYHNWVVJG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |