C8H7N3O2S — CID 110689621
N-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide (PubChem CID 110689621) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110689621 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide |
| SMILES | Cc1csc(NC(=O)c2cocn2)n1 |
| InChI | InChI=1S/C8H7N3O2S/c1-5-3-14-8(10-5)11-7(12)6-2-13-4-9-6/h2-4H,1H3,(H,10,11,12) |
| InChIKey | MVJJQSKRIPEAQL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |