C12H11N3O3S — CID 44997307
N-(3-hydroxyphenyl)-N'-(4-methyl-1,3-thiazol-2-yl)oxamide (PubChem CID 44997307) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-N'-(4-methyl-1,3-thiazol-2-yl)oxamide.
| Compound Name | N-(3-hydroxyphenyl)-N'-(4-methyl-1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 44997307 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N-(3-hydroxyphenyl)-N'-(4-methyl-1,3-thiazol-2-yl)oxamide |
| SMILES | Cc1csc(NC(=O)C(=O)Nc2cccc(O)c2)n1 |
| InChI | InChI=1S/C12H11N3O3S/c1-7-6-19-12(13-7)15-11(18)10(17)14-8-3-2-4-9(16)5-8/h2-6,16H,1H3,(H,14,17)(H,13,15,18) |
| InChIKey | ZKYHKHGYNOSING-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|