C13H13N3O4S — CID 61196286
2-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]phenoxy]acetic acid (PubChem CID 61196286) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]phenoxy]acetic acid.
| Compound Name | 2-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 61196286 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]phenoxy]acetic acid |
| SMILES | Cc1csc(NC(=O)Nc2cccc(OCC(=O)O)c2)n1 |
| InChI | InChI=1S/C13H13N3O4S/c1-8-7-21-13(14-8)16-12(19)15-9-3-2-4-10(5-9)20-6-11(17)18/h2-5,7H,6H2,1H3,(H,17,18)(H2,14,15,16,19) |
| InChIKey | YHZCERHEHFCEDP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |