C14H8Cl4N2O3 — CID 10250012
N-(3-hydroxyphenyl)-N'-(2,3,5,6-tetrachlorophenyl)oxamide (PubChem CID 10250012) has the molecular formula C14H8Cl4N2O3 and a molecular weight of 394.04 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-N'-(2,3,5,6-tetrachlorophenyl)oxamide.
| Compound Name | N-(3-hydroxyphenyl)-N'-(2,3,5,6-tetrachlorophenyl)oxamide |
|---|---|
| PubChem CID | 10250012 |
| Molecular Formula | C14H8Cl4N2O3 |
| Molecular Weight | 394.04 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | N-(3-hydroxyphenyl)-N'-(2,3,5,6-tetrachlorophenyl)oxamide |
| SMILES | O=C(Nc1cccc(O)c1)C(=O)Nc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C14H8Cl4N2O3/c15-8-5-9(16)11(18)12(10(8)17)20-14(23)13(22)19-6-2-1-3-7(21)4-6/h1-5,21H,(H,19,22)(H,20,23) |
| InChIKey | AJOXDAWTKDTNHE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.04 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|