C14H15N3O2S — CID 44997308
N-(4-methyl-1,3-thiazol-2-yl)-N'-(1-phenylethyl)oxamide (PubChem CID 44997308) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-N'-(1-phenylethyl)oxamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-N'-(1-phenylethyl)oxamide |
|---|---|
| PubChem CID | 44997308 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-N'-(1-phenylethyl)oxamide |
| SMILES | Cc1csc(NC(=O)C(=O)NC(C)c2ccccc2)n1 |
| InChI | InChI=1S/C14H15N3O2S/c1-9-8-20-14(15-9)17-13(19)12(18)16-10(2)11-6-4-3-5-7-11/h3-8,10H,1-2H3,(H,16,18)(H,15,17,19) |
| InChIKey | MXVMSYGQQDQCEC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|