C16H21N3OS — CID 78892751
1-(2,2-dimethyl-1-phenylpropyl)-3-(4-methyl-1,3-thiazol-2-yl)urea (PubChem CID 78892751) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-(2,2-dimethyl-1-phenylpropyl)-3-(4-methyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(2,2-dimethyl-1-phenylpropyl)-3-(4-methyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 78892751 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-(2,2-dimethyl-1-phenylpropyl)-3-(4-methyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1csc(NC(=O)NC(c2ccccc2)C(C)(C)C)n1 |
| InChI | InChI=1S/C16H21N3OS/c1-11-10-21-15(17-11)19-14(20)18-13(16(2,3)4)12-8-6-5-7-9-12/h5-10,13H,1-4H3,(H2,17,18,19,20) |
| InChIKey | UCAWMUYQEMSNGX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |