C11H21N3OS — CID 143608747
1-tert-butyl-3-(4-methyl-1,3-thiazol-2-yl)urea;ethane (PubChem CID 143608747) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 1-tert-butyl-3-(4-methyl-1,3-thiazol-2-yl)urea;ethane.
| Compound Name | 1-tert-butyl-3-(4-methyl-1,3-thiazol-2-yl)urea;ethane |
|---|---|
| PubChem CID | 143608747 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-tert-butyl-3-(4-methyl-1,3-thiazol-2-yl)urea;ethane |
| SMILES | CC.Cc1csc(NC(=O)NC(C)(C)C)n1 |
| InChI | InChI=1S/C9H15N3OS.C2H6/c1-6-5-14-8(10-6)11-7(13)12-9(2,3)4;1-2/h5H,1-4H3,(H2,10,11,12,13);1-2H3 |
| InChIKey | LCZKYIXPQYEFKJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |