C8H8N2OS — CID 130635299
N-(4-methyl-1,3-thiazol-2-yl)but-2-ynamide (PubChem CID 130635299) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)but-2-ynamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)but-2-ynamide |
|---|---|
| PubChem CID | 130635299 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)but-2-ynamide |
| SMILES | CC#CC(=O)Nc1nc(C)cs1 |
| InChI | InChI=1S/C8H8N2OS/c1-3-4-7(11)10-8-9-6(2)5-12-8/h5H,1-2H3,(H,9,10,11) |
| InChIKey | KJPMSHJXWKWWBN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|