C20H19N3O2S — CID 2113874
N-[(1R)-3-[(4-methyl-1,3-thiazol-2-yl)amino]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 2113874) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[(1R)-3-[(4-methyl-1,3-thiazol-2-yl)amino]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | N-[(1R)-3-[(4-methyl-1,3-thiazol-2-yl)amino]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 2113874 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[(1R)-3-[(4-methyl-1,3-thiazol-2-yl)amino]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | Cc1csc(NC(=O)C[C@@H](NC(=O)c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C20H19N3O2S/c1-14-13-26-20(21-14)23-18(24)12-17(15-8-4-2-5-9-15)22-19(25)16-10-6-3-7-11-16/h2-11,13,17H,12H2,1H3,(H,22,25)(H,21,23,24)/t17-/m1/s1 |
| InChIKey | SWVKWZTWISLPIA-QGZVFWFLSA-N |
| XLogP | 3.95 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |