C23H22N2O2 — CID 7946567
N-[(1R)-3-(2-methylanilino)-3-oxo-1-phenylpropyl]benzamide (PubChem CID 7946567) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[(1R)-3-(2-methylanilino)-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | N-[(1R)-3-(2-methylanilino)-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 7946567 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[(1R)-3-(2-methylanilino)-3-oxo-1-phenylpropyl]benzamide |
| SMILES | Cc1ccccc1NC(=O)C[C@@H](NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O2/c1-17-10-8-9-15-20(17)24-22(26)16-21(18-11-4-2-5-12-18)25-23(27)19-13-6-3-7-14-19/h2-15,21H,16H2,1H3,(H,24,26)(H,25,27)/t21-/m1/s1 |
| InChIKey | CHSOMJJUKZOICZ-OAQYLSRUSA-N |
| XLogP | 4.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |