C10H16N4O2S — CID 44997250
N-[2-(dimethylamino)ethyl]-N'-(4-methyl-1,3-thiazol-2-yl)oxamide (PubChem CID 44997250) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-(4-methyl-1,3-thiazol-2-yl)oxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-(4-methyl-1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 44997250 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-(4-methyl-1,3-thiazol-2-yl)oxamide |
| SMILES | Cc1csc(NC(=O)C(=O)NCCN(C)C)n1 |
| InChI | InChI=1S/C10H16N4O2S/c1-7-6-17-10(12-7)13-9(16)8(15)11-4-5-14(2)3/h6H,4-5H2,1-3H3,(H,11,15)(H,12,13,16) |
| InChIKey | XGOPWIKLYHBJQB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|