C10H14N2OS — CID 75895895
2-methyl-N-(4-methyl-1,3-thiazol-2-yl)pent-2-enamide (PubChem CID 75895895) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)pent-2-enamide.
| Compound Name | 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)pent-2-enamide |
|---|---|
| PubChem CID | 75895895 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)pent-2-enamide |
| SMILES | CCC=C(C)C(=O)Nc1nc(C)cs1 |
| InChI | InChI=1S/C10H14N2OS/c1-4-5-7(2)9(13)12-10-11-8(3)6-14-10/h5-6H,4H2,1-3H3,(H,11,12,13) |
| InChIKey | MRVKIOOROZZVQF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|