C9H14N2O2S — CID 79198899
5-hydroxy-N-(4-methyl-1,3-thiazol-2-yl)pentanamide (PubChem CID 79198899) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 5-hydroxy-N-(4-methyl-1,3-thiazol-2-yl)pentanamide.
| Compound Name | 5-hydroxy-N-(4-methyl-1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 79198899 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 5-hydroxy-N-(4-methyl-1,3-thiazol-2-yl)pentanamide |
| SMILES | Cc1csc(NC(=O)CCCCO)n1 |
| InChI | InChI=1S/C9H14N2O2S/c1-7-6-14-9(10-7)11-8(13)4-2-3-5-12/h6,12H,2-5H2,1H3,(H,10,11,13) |
| InChIKey | AYGMGHCJXOMRBD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|