C13H21N3O3S — CID 47116057
tert-butyl N-[4-[(4-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]carbamate (PubChem CID 47116057) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is tert-butyl N-[4-[(4-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[(4-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 47116057 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | tert-butyl N-[4-[(4-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]carbamate |
| SMILES | Cc1csc(NC(=O)CCCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C13H21N3O3S/c1-9-8-20-11(15-9)16-10(17)6-5-7-14-12(18)19-13(2,3)4/h8H,5-7H2,1-4H3,(H,14,18)(H,15,16,17) |
| InChIKey | SYRIJMISQMJXSW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|