C21H29N3O3S — CID 8927471
tert-butyl N-[4-oxo-4-[[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]amino]butyl]carbamate (PubChem CID 8927471) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-[[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-[[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 8927471 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | tert-butyl N-[4-oxo-4-[[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]amino]butyl]carbamate |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)CCCNC(=O)OC(C)(C)C)n2)c(C)c1 |
| InChI | InChI=1S/C21H29N3O3S/c1-13-10-14(2)18(15(3)11-13)16-12-28-19(23-16)24-17(25)8-7-9-22-20(26)27-21(4,5)6/h10-12H,7-9H2,1-6H3,(H,22,26)(H,23,24,25) |
| InChIKey | LMDOCJSVWIMQBS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|