C19H26N4O2S2 — CID 84560225
tert-butyl N-[2-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]carbamothioylamino]ethyl]carbamate (PubChem CID 84560225) has the molecular formula C19H26N4O2S2 and a molecular weight of 406.58 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]carbamothioylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 84560225 |
| Molecular Formula | C19H26N4O2S2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | tert-butyl N-[2-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]carbamothioylamino]ethyl]carbamate |
| SMILES | Cc1ccc(-c2csc(NC(=S)NCCNC(=O)OC(C)(C)C)n2)cc1C |
| InChI | InChI=1S/C19H26N4O2S2/c1-12-6-7-14(10-13(12)2)15-11-27-17(22-15)23-16(26)20-8-9-21-18(24)25-19(3,4)5/h6-7,10-11H,8-9H2,1-5H3,(H,21,24)(H2,20,22,23,26) |
| InChIKey | BXGHKBXTVLRSEF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|