C12H18N4O5S — CID 175095293
tert-butyl N-[4-[(5-nitro-1,3-thiazol-2-yl)amino]-4-oxobutyl]carbamate (PubChem CID 175095293) has the molecular formula C12H18N4O5S and a molecular weight of 330.37 g/mol. Its IUPAC name is tert-butyl N-[4-[(5-nitro-1,3-thiazol-2-yl)amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[(5-nitro-1,3-thiazol-2-yl)amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 175095293 |
| Molecular Formula | C12H18N4O5S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | tert-butyl N-[4-[(5-nitro-1,3-thiazol-2-yl)amino]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H18N4O5S/c1-12(2,3)21-11(18)13-6-4-5-8(17)15-10-14-7-9(22-10)16(19)20/h7H,4-6H2,1-3H3,(H,13,18)(H,14,15,17) |
| InChIKey | VFRFZJLMEFMXPV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|