C9H13N3O3S — CID 4634913
2,2-dimethyl-N-(5-nitro-1,3-thiazol-2-yl)butanamide (PubChem CID 4634913) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2,2-dimethyl-N-(5-nitro-1,3-thiazol-2-yl)butanamide.
| Compound Name | 2,2-dimethyl-N-(5-nitro-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 4634913 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2,2-dimethyl-N-(5-nitro-1,3-thiazol-2-yl)butanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H13N3O3S/c1-4-9(2,3)7(13)11-8-10-5-6(16-8)12(14)15/h5H,4H2,1-3H3,(H,10,11,13) |
| InChIKey | LYDRQFONFNNCDN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|