C9H15N5O3S — CID 58817802
1-[3-(dimethylamino)propyl]-3-(5-nitro-1,3-thiazol-2-yl)urea (PubChem CID 58817802) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-(5-nitro-1,3-thiazol-2-yl)urea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-(5-nitro-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 58817802 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-(5-nitro-1,3-thiazol-2-yl)urea |
| SMILES | CN(C)CCCNC(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H15N5O3S/c1-13(2)5-3-4-10-8(15)12-9-11-6-7(18-9)14(16)17/h6H,3-5H2,1-2H3,(H2,10,11,12,15) |
| InChIKey | VHTQJLCJVRNQBY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|