C11H9FN4O3S — CID 126601240
1-[(3-fluorophenyl)methyl]-3-(5-nitro-1,3-thiazol-2-yl)urea (PubChem CID 126601240) has the molecular formula C11H9FN4O3S and a molecular weight of 296.28 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-(5-nitro-1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-(5-nitro-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 126601240 |
| Molecular Formula | C11H9FN4O3S |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-(5-nitro-1,3-thiazol-2-yl)urea |
| SMILES | O=C(NCc1cccc(F)c1)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H9FN4O3S/c12-8-3-1-2-7(4-8)5-13-10(17)15-11-14-6-9(20-11)16(18)19/h1-4,6H,5H2,(H2,13,14,15,17) |
| InChIKey | DKPAATTVQUQUQM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|