C10H7ClN4O3S — CID 4672772
1-(3-chlorophenyl)-3-(5-nitro-1,3-thiazol-2-yl)urea (PubChem CID 4672772) has the molecular formula C10H7ClN4O3S and a molecular weight of 298.71 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(5-nitro-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(3-chlorophenyl)-3-(5-nitro-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 4672772 |
| Molecular Formula | C10H7ClN4O3S |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(5-nitro-1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H7ClN4O3S/c11-6-2-1-3-7(4-6)13-9(16)14-10-12-5-8(19-10)15(17)18/h1-5H,(H2,12,13,14,16) |
| InChIKey | NXPUNELXXALIHY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|