C14H12ClN2O — CID 168763640
CID 168763640 (PubChem CID 168763640) has the molecular formula C14H12ClN2O and a molecular weight of 259.72 g/mol.
| Compound Name | CID 168763640 |
|---|---|
| PubChem CID | 168763640 |
| Molecular Formula | C14H12ClN2O |
| Molecular Weight | 259.72 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | — |
| SMILES | [CH2]c1ccc(NC(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C14H12ClN2O/c1-10-5-7-12(8-6-10)16-14(18)17-13-4-2-3-11(15)9-13/h2-9H,1H2,(H2,16,17,18) |
| InChIKey | AYTGYPWYDKSOST-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |