C39H28Cl2N4O2 — CID 4922946
1-(3-chlorophenyl)-3-[4-[9-[4-[(3-chlorophenyl)carbamoylamino]phenyl]fluoren-9-yl]phenyl]urea (PubChem CID 4922946) has the molecular formula C39H28Cl2N4O2 and a molecular weight of 655.59 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-[9-[4-[(3-chlorophenyl)carbamoylamino]phenyl]fluoren-9-yl]phenyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-[9-[4-[(3-chlorophenyl)carbamoylamino]phenyl]fluoren-9-yl]phenyl]urea |
|---|---|
| PubChem CID | 4922946 |
| Molecular Formula | C39H28Cl2N4O2 |
| Molecular Weight | 655.59 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-[9-[4-[(3-chlorophenyl)carbamoylamino]phenyl]fluoren-9-yl]phenyl]urea |
| SMILES | O=C(Nc1ccc(C2(c3ccc(NC(=O)Nc4cccc(Cl)c4)cc3)c3ccccc3-c3ccccc32)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C39H28Cl2N4O2/c40-27-7-5-9-31(23-27)44-37(46)42-29-19-15-25(16-20-29)39(35-13-3-1-11-33(35)34-12-2-4-14-36(34)39)26-17-21-30(22-18-26)43-38(47)45-32-10-6-8-28(41)24-32/h1-24H,(H2,42,44,46)(H2,43,45,47) |
| InChIKey | VLIHILFSJIFDSK-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.59 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |