C30H31ClN4O4 — CID 69341761
1-(3-chlorophenyl)-3-(4-ethoxyphenyl)urea;1-(4-ethoxyphenyl)-3-phenylurea (PubChem CID 69341761) has the molecular formula C30H31ClN4O4 and a molecular weight of 547.06 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(4-ethoxyphenyl)urea;1-(4-ethoxyphenyl)-3-phenylurea.
| Compound Name | 1-(3-chlorophenyl)-3-(4-ethoxyphenyl)urea;1-(4-ethoxyphenyl)-3-phenylurea |
|---|---|
| PubChem CID | 69341761 |
| Molecular Formula | C30H31ClN4O4 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(4-ethoxyphenyl)urea;1-(4-ethoxyphenyl)-3-phenylurea |
| SMILES | CCOc1ccc(NC(=O)Nc2cccc(Cl)c2)cc1.CCOc1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C15H15ClN2O2.C15H16N2O2/c1-2-20-14-8-6-12(7-9-14)17-15(19)18-13-5-3-4-11(16)10-13;1-2-19-14-10-8-13(9-11-14)17-15(18)16-12-6-4-3-5-7-12/h3-10H,2H2,1H3,(H2,17,18,19);3-11H,2H2,1H3,(H2,16,17,18) |
| InChIKey | SGPATHBNVXZMDA-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |